C17H19ClN2O2 — CID 108877992
3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-methyl-1-phenylurea (PubChem CID 108877992) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-methyl-1-phenylurea.
| Compound Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-methyl-1-phenylurea |
|---|---|
| PubChem CID | 108877992 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-methyl-1-phenylurea |
| SMILES | Cc1cc(OCNC(=O)N(C)c2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C17H19ClN2O2/c1-12-9-15(10-13(2)16(12)18)22-11-19-17(21)20(3)14-7-5-4-6-8-14/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | NABJPGHTHQPIDT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|