C18H20ClN3O3 — CID 108877848
N-(4-aminophenyl)-N-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoyl]acetamide (PubChem CID 108877848) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(4-aminophenyl)-N-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoyl]acetamide.
| Compound Name | N-(4-aminophenyl)-N-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 108877848 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(4-aminophenyl)-N-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoyl]acetamide |
| SMILES | CC(=O)N(C(=O)NCOc1cc(C)c(Cl)c(C)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-11-8-16(9-12(2)17(11)19)25-10-21-18(24)22(13(3)23)15-6-4-14(20)5-7-15/h4-9H,10,20H2,1-3H3,(H,21,24) |
| InChIKey | MPWMKIYQTSPQDG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|