C16H18ClNO — CID 43519772
4-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]aniline (PubChem CID 43519772) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 4-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]aniline.
| Compound Name | 4-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 43519772 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]aniline |
| SMILES | Cc1cc(OCCc2ccc(N)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C16H18ClNO/c1-11-9-15(10-12(2)16(11)17)19-8-7-13-3-5-14(18)6-4-13/h3-6,9-10H,7-8,18H2,1-2H3 |
| InChIKey | OPJJOSXMNOENIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|