C17H20ClNO2 — CID 22683215
[3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]methanamine (PubChem CID 22683215) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is [3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]methanamine.
| Compound Name | [3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 22683215 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]methanamine |
| SMILES | Cc1cc(OCCOc2cccc(CN)c2)cc(C)c1Cl |
| InChI | InChI=1S/C17H20ClNO2/c1-12-8-16(9-13(2)17(12)18)21-7-6-20-15-5-3-4-14(10-15)11-19/h3-5,8-10H,6-7,11,19H2,1-2H3 |
| InChIKey | NBTWDMJIDRIDAC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|