C17H20ClNO2 — CID 43531016
[3-[3-(2-chloro-5-methylphenoxy)propoxy]phenyl]methanamine (PubChem CID 43531016) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is [3-[3-(2-chloro-5-methylphenoxy)propoxy]phenyl]methanamine.
| Compound Name | [3-[3-(2-chloro-5-methylphenoxy)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 43531016 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [3-[3-(2-chloro-5-methylphenoxy)propoxy]phenyl]methanamine |
| SMILES | Cc1ccc(Cl)c(OCCCOc2cccc(CN)c2)c1 |
| InChI | InChI=1S/C17H20ClNO2/c1-13-6-7-16(18)17(10-13)21-9-3-8-20-15-5-2-4-14(11-15)12-19/h2,4-7,10-11H,3,8-9,12,19H2,1H3 |
| InChIKey | VYDZGIRKZJJXGU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|