C16H17Cl2NO2 — CID 43531172
[3-[3-(2,4-dichlorophenoxy)propoxy]phenyl]methanamine (PubChem CID 43531172) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is [3-[3-(2,4-dichlorophenoxy)propoxy]phenyl]methanamine.
| Compound Name | [3-[3-(2,4-dichlorophenoxy)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 43531172 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [3-[3-(2,4-dichlorophenoxy)propoxy]phenyl]methanamine |
| SMILES | NCc1cccc(OCCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO2/c17-13-5-6-16(15(18)10-13)21-8-2-7-20-14-4-1-3-12(9-14)11-19/h1,3-6,9-10H,2,7-8,11,19H2 |
| InChIKey | ZCFKDDFULJYJCT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|