C15H20ClN3O — CID 62130694
[3-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methanamine (PubChem CID 62130694) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is [3-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methanamine.
| Compound Name | [3-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 62130694 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [3-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methanamine |
| SMILES | Cc1nn(CCCOc2cccc(CN)c2)c(C)c1Cl |
| InChI | InChI=1S/C15H20ClN3O/c1-11-15(16)12(2)19(18-11)7-4-8-20-14-6-3-5-13(9-14)10-17/h3,5-6,9H,4,7-8,10,17H2,1-2H3 |
| InChIKey | RVXPMAOVXHXAIJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|