C12H15N4O2Tl — CID 154555049
[3-[3-[3-(aminomethyl)phenoxy]propoxy]-1,2,4-triazol-1-yl]thallium (PubChem CID 154555049) has the molecular formula C12H15N4O2Tl and a molecular weight of 451.66 g/mol. Its IUPAC name is [3-[3-[3-(aminomethyl)phenoxy]propoxy]-1,2,4-triazol-1-yl]thallium.
| Compound Name | [3-[3-[3-(aminomethyl)phenoxy]propoxy]-1,2,4-triazol-1-yl]thallium |
|---|---|
| PubChem CID | 154555049 |
| Molecular Formula | C12H15N4O2Tl |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | [3-[3-[3-(aminomethyl)phenoxy]propoxy]-1,2,4-triazol-1-yl]thallium |
| SMILES | NCc1cccc(OCCCOc2ncn([Tl])n2)c1 |
| InChI | InChI=1S/C12H15N4O2.Tl/c13-8-10-3-1-4-11(7-10)17-5-2-6-18-12-14-9-15-16-12;/h1,3-4,7,9H,2,5-6,8,13H2;/q-1;+1 |
| InChIKey | KVMGHURJDPIOKL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|