C15H12F3NO2 — CID 26358716
2-ethoxy-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 26358716) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-ethoxy-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 2-ethoxy-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 26358716 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-ethoxy-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12F3NO2/c1-2-21-12-6-4-3-5-9(12)15(20)19-11-8-7-10(16)13(17)14(11)18/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | NVRVIOHMXDVHPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|