C32H32N2O4 — CID 4556792
2-ethoxy-N-[4-[4-[(2-ethoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide (PubChem CID 4556792) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-ethoxy-N-[4-[4-[(2-ethoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-[4-[(2-ethoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 4556792 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-ethoxy-N-[4-[4-[(2-ethoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(-c2ccc(NC(=O)c3ccccc3OCC)c(C)c2)cc1C |
| InChI | InChI=1S/C32H32N2O4/c1-5-37-29-13-9-7-11-25(29)31(35)33-27-17-15-23(19-21(27)3)24-16-18-28(22(4)20-24)34-32(36)26-12-8-10-14-30(26)38-6-2/h7-20H,5-6H2,1-4H3,(H,33,35)(H,34,36) |
| InChIKey | GKUYSALOMGTNHI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |