C34H42F2N4O4 — CID 69143674
4-(1-butylpiperidin-4-yl)oxy-N-[4-[2,5-difluoro-4-(pentylcarbamoylamino)phenoxy]phenyl]benzamide (PubChem CID 69143674) has the molecular formula C34H42F2N4O4 and a molecular weight of 608.73 g/mol. Its IUPAC name is 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2,5-difluoro-4-(pentylcarbamoylamino)phenoxy]phenyl]benzamide.
| Compound Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2,5-difluoro-4-(pentylcarbamoylamino)phenoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 69143674 |
| Molecular Formula | C34H42F2N4O4 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2,5-difluoro-4-(pentylcarbamoylamino)phenoxy]phenyl]benzamide |
| SMILES | CCCCCNC(=O)Nc1cc(F)c(Oc2ccc(NC(=O)c3ccc(OC4CCN(CCCC)CC4)cc3)cc2)cc1F |
| InChI | InChI=1S/C34H42F2N4O4/c1-3-5-7-18-37-34(42)39-31-22-30(36)32(23-29(31)35)44-27-14-10-25(11-15-27)38-33(41)24-8-12-26(13-9-24)43-28-16-20-40(21-17-28)19-6-4-2/h8-15,22-23,28H,3-7,16-21H2,1-2H3,(H,38,41)(H2,37,39,42) |
| InChIKey | DLTWTQCQPDJJQT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|