C39H54N4O6 — CID 69145220
4-(1-butylpiperidin-4-yl)oxy-N-[4-[2-ethoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]-N-(2-methoxyethyl)benzamide (PubChem CID 69145220) has the molecular formula C39H54N4O6 and a molecular weight of 674.88 g/mol. Its IUPAC name is 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2-ethoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2-ethoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 69145220 |
| Molecular Formula | C39H54N4O6 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-[2-ethoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]-N-(2-methoxyethyl)benzamide |
| SMILES | CCCCCNC(=O)Nc1ccc(Oc2ccc(N(CCOC)C(=O)c3ccc(OC4CCN(CCCC)CC4)cc3)cc2)c(OCC)c1 |
| InChI | InChI=1S/C39H54N4O6/c1-5-8-10-23-40-39(45)41-31-13-20-36(37(29-31)47-7-3)49-34-18-14-32(15-19-34)43(27-28-46-4)38(44)30-11-16-33(17-12-30)48-35-21-25-42(26-22-35)24-9-6-2/h11-20,29,35H,5-10,21-28H2,1-4H3,(H2,40,41,45) |
| InChIKey | ILVIEDAISKRYRR-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|