C37H48N4O7 — CID 91347499
4-[4-[4-[[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]-phenylcarbamoyl]phenoxy]piperidin-1-yl]butyl acetate (PubChem CID 91347499) has the molecular formula C37H48N4O7 and a molecular weight of 660.81 g/mol. Its IUPAC name is 4-[4-[4-[[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]-phenylcarbamoyl]phenoxy]piperidin-1-yl]butyl acetate.
| Compound Name | 4-[4-[4-[[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]-phenylcarbamoyl]phenoxy]piperidin-1-yl]butyl acetate |
|---|---|
| PubChem CID | 91347499 |
| Molecular Formula | C37H48N4O7 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 4-[4-[4-[[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]-phenylcarbamoyl]phenoxy]piperidin-1-yl]butyl acetate |
| SMILES | CCC(CC)NC(=O)Nc1ccc(ON(C(=O)c2ccc(OC3CCN(CCCCOC(C)=O)CC3)cc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C37H48N4O7/c1-5-29(6-2)38-37(44)39-30-16-19-34(35(26-30)45-4)48-41(31-12-8-7-9-13-31)36(43)28-14-17-32(18-15-28)47-33-20-23-40(24-21-33)22-10-11-25-46-27(3)42/h7-9,12-19,26,29,33H,5-6,10-11,20-25H2,1-4H3,(H2,38,39,44) |
| InChIKey | BXQLNXGOJIATIT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|