C36H48N4O6 — CID 69144842
N-[4-[1-(4-hydroxybutyl)piperidin-4-yl]oxyphenyl]-N-[4-[2-methoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]acetamide (PubChem CID 69144842) has the molecular formula C36H48N4O6 and a molecular weight of 632.80 g/mol. Its IUPAC name is N-[4-[1-(4-hydroxybutyl)piperidin-4-yl]oxyphenyl]-N-[4-[2-methoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]acetamide.
| Compound Name | N-[4-[1-(4-hydroxybutyl)piperidin-4-yl]oxyphenyl]-N-[4-[2-methoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 69144842 |
| Molecular Formula | C36H48N4O6 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | N-[4-[1-(4-hydroxybutyl)piperidin-4-yl]oxyphenyl]-N-[4-[2-methoxy-4-(pentylcarbamoylamino)phenoxy]phenyl]acetamide |
| SMILES | CCCCCNC(=O)Nc1ccc(Oc2ccc(N(C(C)=O)c3ccc(OC4CCN(CCCCO)CC4)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C36H48N4O6/c1-4-5-6-21-37-36(43)38-28-9-18-34(35(26-28)44-3)46-32-16-12-30(13-17-32)40(27(2)42)29-10-14-31(15-11-29)45-33-19-23-39(24-20-33)22-7-8-25-41/h9-18,26,33,41H,4-8,19-25H2,1-3H3,(H2,37,38,43) |
| InChIKey | YTRFQNVVGADKOK-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|