C30H36N2O4 — CID 91359232
4-(1-butylpiperidin-4-yl)oxy-N-[4-(2-methoxyphenoxy)phenyl]-3-methylbenzamide (PubChem CID 91359232) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-(1-butylpiperidin-4-yl)oxy-N-[4-(2-methoxyphenoxy)phenyl]-3-methylbenzamide.
| Compound Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-(2-methoxyphenoxy)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 91359232 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 4-(1-butylpiperidin-4-yl)oxy-N-[4-(2-methoxyphenoxy)phenyl]-3-methylbenzamide |
| SMILES | CCCCN1CCC(Oc2ccc(C(=O)Nc3ccc(Oc4ccccc4OC)cc3)cc2C)CC1 |
| InChI | InChI=1S/C30H36N2O4/c1-4-5-18-32-19-16-26(17-20-32)35-27-15-10-23(21-22(27)2)30(33)31-24-11-13-25(14-12-24)36-29-9-7-6-8-28(29)34-3/h6-15,21,26H,4-5,16-20H2,1-3H3,(H,31,33) |
| InChIKey | HVYCIRKVCOIANC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |