C19H22F3N3O2 — CID 69190108
1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-3-pentylurea (PubChem CID 69190108) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-3-pentylurea.
| Compound Name | 1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 69190108 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1ccc(Oc2ccc(N)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-2-3-4-11-24-18(26)25-14-7-10-17(16(12-14)19(20,21)22)27-15-8-5-13(23)6-9-15/h5-10,12H,2-4,11,23H2,1H3,(H2,24,25,26) |
| InChIKey | CVJAHNUGLJHGJQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|