C17H22N4O4S — CID 87787228
2-[2-[(2-amino-1,3-thiazol-5-yl)oxy]-5-(pentylcarbamoylamino)phenyl]acetic acid (PubChem CID 87787228) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[2-[(2-amino-1,3-thiazol-5-yl)oxy]-5-(pentylcarbamoylamino)phenyl]acetic acid.
| Compound Name | 2-[2-[(2-amino-1,3-thiazol-5-yl)oxy]-5-(pentylcarbamoylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 87787228 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[2-[(2-amino-1,3-thiazol-5-yl)oxy]-5-(pentylcarbamoylamino)phenyl]acetic acid |
| SMILES | CCCCCNC(=O)Nc1ccc(Oc2cnc(N)s2)c(CC(=O)O)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-2-3-4-7-19-17(24)21-12-5-6-13(11(8-12)9-14(22)23)25-15-10-20-16(18)26-15/h5-6,8,10H,2-4,7,9H2,1H3,(H2,18,20)(H,22,23)(H2,19,21,24) |
| InChIKey | ZLYALLXFYBDUFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|