C20H22F3N3O3 — CID 166198454
N,N-dimethyl-4-[[4-[2-(trifluoromethyl)phenoxy]phenyl]carbamoylamino]butanamide (PubChem CID 166198454) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-[2-(trifluoromethyl)phenoxy]phenyl]carbamoylamino]butanamide.
| Compound Name | N,N-dimethyl-4-[[4-[2-(trifluoromethyl)phenoxy]phenyl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 166198454 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N,N-dimethyl-4-[[4-[2-(trifluoromethyl)phenoxy]phenyl]carbamoylamino]butanamide |
| SMILES | CN(C)C(=O)CCCNC(=O)Nc1ccc(Oc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-26(2)18(27)8-5-13-24-19(28)25-14-9-11-15(12-10-14)29-17-7-4-3-6-16(17)20(21,22)23/h3-4,6-7,9-12H,5,8,13H2,1-2H3,(H2,24,25,28) |
| InChIKey | CMTLOQWUQRIQOH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|