C15H22F3N3O2 — CID 47034682
1-(4-ethoxyphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 47034682) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 47034682 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCCN(C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3N3O2/c1-3-23-13-7-5-12(6-8-13)20-14(22)19-9-4-10-21(2)11-15(16,17)18/h5-8H,3-4,9-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | IFBMQFMBGFCKGV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|