C21H24F4N4O2 — CID 55809066
N-[(2-fluorophenyl)methyl]-4-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide (PubChem CID 55809066) has the molecular formula C21H24F4N4O2 and a molecular weight of 440.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55809066 |
| Molecular Formula | C21H24F4N4O2 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide |
| SMILES | CN(CCCNC(=O)Nc1ccc(C(=O)NCc2ccccc2F)cc1)CC(F)(F)F |
| InChI | InChI=1S/C21H24F4N4O2/c1-29(14-21(23,24)25)12-4-11-26-20(31)28-17-9-7-15(8-10-17)19(30)27-13-16-5-2-3-6-18(16)22/h2-3,5-10H,4,11-14H2,1H3,(H,27,30)(H2,26,28,31) |
| InChIKey | HGASETJWMGLYHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|