C20H24F3N3O2 — CID 55720127
N-[3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylamino]-3-oxopropyl]naphthalene-2-carboxamide (PubChem CID 55720127) has the molecular formula C20H24F3N3O2 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylamino]-3-oxopropyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylamino]-3-oxopropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 55720127 |
| Molecular Formula | C20H24F3N3O2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylamino]-3-oxopropyl]naphthalene-2-carboxamide |
| SMILES | CN(CCCNC(=O)CCNC(=O)c1ccc2ccccc2c1)CC(F)(F)F |
| InChI | InChI=1S/C20H24F3N3O2/c1-26(14-20(21,22)23)12-4-10-24-18(27)9-11-25-19(28)17-8-7-15-5-2-3-6-16(15)13-17/h2-3,5-8,13H,4,9-12,14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | DXMKQVDMGBJONX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|