C19H24F3N3O — CID 46481948
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 46481948) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 46481948 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)CC(F)(F)F |
| InChI | InChI=1S/C19H24F3N3O/c1-25(12-19(20,21)22)10-4-9-23-18(26)13-7-8-17-15(11-13)14-5-2-3-6-16(14)24-17/h7-8,11,24H,2-6,9-10,12H2,1H3,(H,23,26) |
| InChIKey | FYYGVUSZANBMTN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|