C19H21F3N4O3 — CID 55720906
4-anilino-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-nitrobenzamide (PubChem CID 55720906) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is 4-anilino-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-nitrobenzamide.
| Compound Name | 4-anilino-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55720906 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-anilino-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-nitrobenzamide |
| SMILES | CN(CCCNC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1)CC(F)(F)F |
| InChI | InChI=1S/C19H21F3N4O3/c1-25(13-19(20,21)22)11-5-10-23-18(27)14-8-9-16(17(12-14)26(28)29)24-15-6-3-2-4-7-15/h2-4,6-9,12,24H,5,10-11,13H2,1H3,(H,23,27) |
| InChIKey | CALCCAZIJYPBDD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|