C20H26ClN5O3 — CID 119393332
4-anilino-3-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119393332) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 4-anilino-3-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 4-anilino-3-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119393332 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-anilino-3-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O3.ClH/c26-20(22-9-4-12-24-13-10-21-11-14-24)16-7-8-18(19(15-16)25(27)28)23-17-5-2-1-3-6-17;/h1-3,5-8,15,21,23H,4,9-14H2,(H,22,26);1H |
| InChIKey | XZYOWYVWZITCOT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|