C19H24ClN5O3 — CID 119447833
4-anilino-3-nitro-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119447833) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 4-anilino-3-nitro-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-anilino-3-nitro-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119447833 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-anilino-3-nitro-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N5O3.ClH/c25-19(21-10-13-23-11-8-20-9-12-23)15-6-7-17(18(14-15)24(26)27)22-16-4-2-1-3-5-16;/h1-7,14,20,22H,8-13H2,(H,21,25);1H |
| InChIKey | UXMGPFVFOPYHDA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|