C20H23ClN4O3 — CID 119637991
(4-anilino-3-nitrophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride (PubChem CID 119637991) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (4-anilino-3-nitrophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride.
| Compound Name | (4-anilino-3-nitrophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119637991 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (4-anilino-3-nitrophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C20H22N4O3.ClH/c25-20(23-11-10-16-7-8-17(13-23)21-16)14-6-9-18(19(12-14)24(26)27)22-15-4-2-1-3-5-15;/h1-6,9,12,16-17,21-22H,7-8,10-11,13H2;1H |
| InChIKey | YJHNTKVGLLLLIU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|