C19H23ClN4O3 — CID 119651008
(4-anilino-3-nitrophenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119651008) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is (4-anilino-3-nitrophenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-anilino-3-nitrophenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119651008 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (4-anilino-3-nitrophenyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-20-13-16-8-5-11-22(16)19(24)14-9-10-17(18(12-14)23(25)26)21-15-6-3-2-4-7-15;/h2-4,6-7,9-10,12,16,20-21H,5,8,11,13H2,1H3;1H |
| InChIKey | JJXAYPIYJXPVBB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|