C11H13F3N4O3 — CID 115522197
4-hydrazinyl-3-nitro-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 115522197) has the molecular formula C11H13F3N4O3 and a molecular weight of 306.24 g/mol. Its IUPAC name is 4-hydrazinyl-3-nitro-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 4-hydrazinyl-3-nitro-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 115522197 |
| Molecular Formula | C11H13F3N4O3 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-hydrazinyl-3-nitro-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | NNc1ccc(C(=O)NCCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13F3N4O3/c12-11(13,14)4-1-5-16-10(19)7-2-3-8(17-15)9(6-7)18(20)21/h2-3,6,17H,1,4-5,15H2,(H,16,19) |
| InChIKey | IWFSLKPELZLKBI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|