C15H22F3N3O — CID 47034718
1-(3,5-dimethylphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 47034718) has the molecular formula C15H22F3N3O and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 47034718 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCCCN(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3N3O/c1-11-7-12(2)9-13(8-11)20-14(22)19-5-4-6-21(3)10-15(16,17)18/h7-9H,4-6,10H2,1-3H3,(H2,19,20,22) |
| InChIKey | IDNFGPROAHMHRO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|