C15H24Cl2F3N3O — CID 120669782
2-amino-2-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]acetamide;dihydrochloride (PubChem CID 120669782) has the molecular formula C15H24Cl2F3N3O and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120669782 |
| Molecular Formula | C15H24Cl2F3N3O |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]acetamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCCN(C)CC(F)(F)F)cc1.Cl.Cl |
| InChI | InChI=1S/C15H22F3N3O.2ClH/c1-11-4-6-12(7-5-11)13(19)14(22)20-8-3-9-21(2)10-15(16,17)18;;/h4-7,13H,3,8-10,19H2,1-2H3,(H,20,22);2*1H |
| InChIKey | IZJAWOHAQKSPJP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|