C18H25Cl2N3O — CID 120669990
2-amino-N-(3-anilinopropyl)-2-(4-methylphenyl)acetamide;dihydrochloride (PubChem CID 120669990) has the molecular formula C18H25Cl2N3O and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-amino-N-(3-anilinopropyl)-2-(4-methylphenyl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-(3-anilinopropyl)-2-(4-methylphenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120669990 |
| Molecular Formula | C18H25Cl2N3O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-amino-N-(3-anilinopropyl)-2-(4-methylphenyl)acetamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCCNc2ccccc2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H23N3O.2ClH/c1-14-8-10-15(11-9-14)17(19)18(22)21-13-5-12-20-16-6-3-2-4-7-16;;/h2-4,6-11,17,20H,5,12-13,19H2,1H3,(H,21,22);2*1H |
| InChIKey | IZFSYMHPIVBOEQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|