C18H23ClN4O3 — CID 119332473
2-amino-N-[3-(4-methyl-2-nitroanilino)propyl]-2-phenylacetamide;hydrochloride (PubChem CID 119332473) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-amino-N-[3-(4-methyl-2-nitroanilino)propyl]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(4-methyl-2-nitroanilino)propyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119332473 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-amino-N-[3-(4-methyl-2-nitroanilino)propyl]-2-phenylacetamide;hydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)C(N)c2ccccc2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C18H22N4O3.ClH/c1-13-8-9-15(16(12-13)22(24)25)20-10-5-11-21-18(23)17(19)14-6-3-2-4-7-14;/h2-4,6-9,12,17,20H,5,10-11,19H2,1H3,(H,21,23);1H |
| InChIKey | HZUVSQPAXPIVOG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|