C16H24N4O5 — CID 122003243
2-methyl-3-[methyl-[3-(4-methyl-2-nitroanilino)propylcarbamoyl]amino]propanoic acid (PubChem CID 122003243) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[3-(4-methyl-2-nitroanilino)propylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[3-(4-methyl-2-nitroanilino)propylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122003243 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-methyl-3-[methyl-[3-(4-methyl-2-nitroanilino)propylcarbamoyl]amino]propanoic acid |
| SMILES | Cc1ccc(NCCCNC(=O)N(C)CC(C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N4O5/c1-11-5-6-13(14(9-11)20(24)25)17-7-4-8-18-16(23)19(3)10-12(2)15(21)22/h5-6,9,12,17H,4,7-8,10H2,1-3H3,(H,18,23)(H,21,22) |
| InChIKey | OYRFUXLXTIRVQV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|