C16H27ClN4O3 — CID 119799103
(2S)-2-amino-4-methyl-N-[3-(4-methyl-2-nitroanilino)propyl]pentanamide;hydrochloride (PubChem CID 119799103) has the molecular formula C16H27ClN4O3 and a molecular weight of 358.87 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[3-(4-methyl-2-nitroanilino)propyl]pentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-methyl-N-[3-(4-methyl-2-nitroanilino)propyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119799103 |
| Molecular Formula | C16H27ClN4O3 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[3-(4-methyl-2-nitroanilino)propyl]pentanamide;hydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)[C@@H](N)CC(C)C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C16H26N4O3.ClH/c1-11(2)9-13(17)16(21)19-8-4-7-18-14-6-5-12(3)10-15(14)20(22)23;/h5-6,10-11,13,18H,4,7-9,17H2,1-3H3,(H,19,21);1H/t13-;/m0./s1 |
| InChIKey | MZMZUAZPSMZTCH-ZOWNYOTGSA-N |
| XLogP | 2.62 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|