C18H26Cl2N4O — CID 120670104
2-amino-2-(4-methylphenyl)-N-[4-(pyridin-2-ylamino)butyl]acetamide;dihydrochloride (PubChem CID 120670104) has the molecular formula C18H26Cl2N4O and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-N-[4-(pyridin-2-ylamino)butyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-N-[4-(pyridin-2-ylamino)butyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120670104 |
| Molecular Formula | C18H26Cl2N4O |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-N-[4-(pyridin-2-ylamino)butyl]acetamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCCCNc2ccccn2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H24N4O.2ClH/c1-14-7-9-15(10-8-14)17(19)18(23)22-13-5-4-12-21-16-6-2-3-11-20-16;;/h2-3,6-11,17H,4-5,12-13,19H2,1H3,(H,20,21)(H,22,23);2*1H |
| InChIKey | DLLHDTJVVJECFU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|