C19H28Cl2N4O — CID 119874678
3-amino-2-methyl-3-phenyl-N-[4-(pyridin-2-ylamino)butyl]propanamide;dihydrochloride (PubChem CID 119874678) has the molecular formula C19H28Cl2N4O and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-amino-2-methyl-3-phenyl-N-[4-(pyridin-2-ylamino)butyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-2-methyl-3-phenyl-N-[4-(pyridin-2-ylamino)butyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119874678 |
| Molecular Formula | C19H28Cl2N4O |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-amino-2-methyl-3-phenyl-N-[4-(pyridin-2-ylamino)butyl]propanamide;dihydrochloride |
| SMILES | CC(C(=O)NCCCCNc1ccccn1)C(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H26N4O.2ClH/c1-15(18(20)16-9-3-2-4-10-16)19(24)23-14-8-7-13-22-17-11-5-6-12-21-17;;/h2-6,9-12,15,18H,7-8,13-14,20H2,1H3,(H,21,22)(H,23,24);2*1H |
| InChIKey | LLHIPSTURUNFQB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|