C18H30N2O — CID 119775743
3-amino-N-(5,5-dimethylhexyl)-2-methyl-3-phenylpropanamide (PubChem CID 119775743) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-amino-N-(5,5-dimethylhexyl)-2-methyl-3-phenylpropanamide.
| Compound Name | 3-amino-N-(5,5-dimethylhexyl)-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 119775743 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 3-amino-N-(5,5-dimethylhexyl)-2-methyl-3-phenylpropanamide |
| SMILES | CC(C(=O)NCCCCC(C)(C)C)C(N)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-14(16(19)15-10-6-5-7-11-15)17(21)20-13-9-8-12-18(2,3)4/h5-7,10-11,14,16H,8-9,12-13,19H2,1-4H3,(H,20,21) |
| InChIKey | OCEFWKNTCCCTDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|