C17H26N2O3 — CID 119686216
methyl 6-[(3-amino-2-methyl-3-phenylpropanoyl)amino]hexanoate (PubChem CID 119686216) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 6-[(3-amino-2-methyl-3-phenylpropanoyl)amino]hexanoate.
| Compound Name | methyl 6-[(3-amino-2-methyl-3-phenylpropanoyl)amino]hexanoate |
|---|---|
| PubChem CID | 119686216 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | methyl 6-[(3-amino-2-methyl-3-phenylpropanoyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C(C)C(N)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O3/c1-13(16(18)14-9-5-3-6-10-14)17(21)19-12-8-4-7-11-15(20)22-2/h3,5-6,9-10,13,16H,4,7-8,11-12,18H2,1-2H3,(H,19,21) |
| InChIKey | TXQJJWGQJYSZIP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|