C17H28N2O — CID 119951271
3-amino-N-(5,5-dimethylhexyl)-3-phenylpropanamide (PubChem CID 119951271) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-amino-N-(5,5-dimethylhexyl)-3-phenylpropanamide.
| Compound Name | 3-amino-N-(5,5-dimethylhexyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 119951271 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-amino-N-(5,5-dimethylhexyl)-3-phenylpropanamide |
| SMILES | CC(C)(C)CCCCNC(=O)CC(N)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O/c1-17(2,3)11-7-8-12-19-16(20)13-15(18)14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13,18H2,1-3H3,(H,19,20) |
| InChIKey | MDJSDXCBWQUIJO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|