C12H15F3N2O — CID 63226653
3-amino-3-phenyl-N-(3,3,3-trifluoropropyl)propanamide (PubChem CID 63226653) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-amino-3-phenyl-N-(3,3,3-trifluoropropyl)propanamide.
| Compound Name | 3-amino-3-phenyl-N-(3,3,3-trifluoropropyl)propanamide |
|---|---|
| PubChem CID | 63226653 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-amino-3-phenyl-N-(3,3,3-trifluoropropyl)propanamide |
| SMILES | NC(CC(=O)NCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)6-7-17-11(18)8-10(16)9-4-2-1-3-5-9/h1-5,10H,6-8,16H2,(H,17,18) |
| InChIKey | RGAOKPBTUQGHNL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |