C15H28Cl2N4O — CID 119874722
(2S)-2-amino-4-methyl-N-[4-(pyridin-2-ylamino)butyl]pentanamide;dihydrochloride (PubChem CID 119874722) has the molecular formula C15H28Cl2N4O and a molecular weight of 351.32 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[4-(pyridin-2-ylamino)butyl]pentanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-4-methyl-N-[4-(pyridin-2-ylamino)butyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119874722 |
| Molecular Formula | C15H28Cl2N4O |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[4-(pyridin-2-ylamino)butyl]pentanamide;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)NCCCCNc1ccccn1.Cl.Cl |
| InChI | InChI=1S/C15H26N4O.2ClH/c1-12(2)11-13(16)15(20)19-10-6-5-9-18-14-7-3-4-8-17-14;;/h3-4,7-8,12-13H,5-6,9-11,16H2,1-2H3,(H,17,18)(H,19,20);2*1H/t13-;;/m0../s1 |
| InChIKey | KFUWHYMFWPDYOK-GXKRWWSZSA-N |
| XLogP | 2.61 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|