C16H22Cl2N4O — CID 119854549
2-(4-aminophenyl)-N-[3-(pyridin-2-ylamino)propyl]acetamide;dihydrochloride (PubChem CID 119854549) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[3-(pyridin-2-ylamino)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[3-(pyridin-2-ylamino)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119854549 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(4-aminophenyl)-N-[3-(pyridin-2-ylamino)propyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)NCCCNc2ccccn2)cc1 |
| InChI | InChI=1S/C16H20N4O.2ClH/c17-14-7-5-13(6-8-14)12-16(21)20-11-3-10-19-15-4-1-2-9-18-15;;/h1-2,4-9H,3,10-12,17H2,(H,18,19)(H,20,21);2*1H |
| InChIKey | YHKNXZMRAWNBNP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|