C15H18N4O — CID 82331463
N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-2-phenylacetamide (PubChem CID 82331463) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 82331463 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-2-phenylacetamide |
| SMILES | Nc1ccc(NCCNC(=O)Cc2ccccc2)nc1 |
| InChI | InChI=1S/C15H18N4O/c16-13-6-7-14(19-11-13)17-8-9-18-15(20)10-12-4-2-1-3-5-12/h1-7,11H,8-10,16H2,(H,17,19)(H,18,20) |
| InChIKey | IUHQJGRDMYEINV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|