C20H30N8O2 — CID 163474647
N,N'-bis[2-[(5-amino-2-pyridinyl)amino]ethyl]hexanediamide (PubChem CID 163474647) has the molecular formula C20H30N8O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N,N'-bis[2-[(5-amino-2-pyridinyl)amino]ethyl]hexanediamide.
| Compound Name | N,N'-bis[2-[(5-amino-2-pyridinyl)amino]ethyl]hexanediamide |
|---|---|
| PubChem CID | 163474647 |
| Molecular Formula | C20H30N8O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N,N'-bis[2-[(5-amino-2-pyridinyl)amino]ethyl]hexanediamide |
| SMILES | Nc1ccc(NCCNC(=O)CCCCC(=O)NCCNc2ccc(N)cn2)nc1 |
| InChI | InChI=1S/C20H30N8O2/c21-15-5-7-17(27-13-15)23-9-11-25-19(29)3-1-2-4-20(30)26-12-10-24-18-8-6-16(22)14-28-18/h5-8,13-14H,1-4,9-12,21-22H2,(H,23,27)(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | BZLINHIGRFUWQK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|