C8H12N4O — CID 43553393
3-[(5-amino-2-pyridinyl)amino]propanamide (PubChem CID 43553393) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-[(5-amino-2-pyridinyl)amino]propanamide.
| Compound Name | 3-[(5-amino-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 43553393 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 3-[(5-amino-2-pyridinyl)amino]propanamide |
| SMILES | NC(=O)CCNc1ccc(N)cn1 |
| InChI | InChI=1S/C8H12N4O/c9-6-1-2-8(12-5-6)11-4-3-7(10)13/h1-2,5H,3-4,9H2,(H2,10,13)(H,11,12) |
| InChIKey | WIACUYLCDUXOTC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |