C16H21N5 — CID 51131507
2-benzyl-1-[3-(pyridin-2-ylamino)propyl]guanidine (PubChem CID 51131507) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-benzyl-1-[3-(pyridin-2-ylamino)propyl]guanidine.
| Compound Name | 2-benzyl-1-[3-(pyridin-2-ylamino)propyl]guanidine |
|---|---|
| PubChem CID | 51131507 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-benzyl-1-[3-(pyridin-2-ylamino)propyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1)NCCCNc1ccccn1 |
| InChI | InChI=1S/C16H21N5/c17-16(21-13-14-7-2-1-3-8-14)20-12-6-11-19-15-9-4-5-10-18-15/h1-5,7-10H,6,11-13H2,(H,18,19)(H3,17,20,21) |
| InChIKey | FIEUMVBONZPYNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|