C22H32N6 — CID 12991061
2-benzyl-1-[6-[(N'-benzylcarbamimidoyl)amino]hexyl]guanidine (PubChem CID 12991061) has the molecular formula C22H32N6 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-benzyl-1-[6-[(N'-benzylcarbamimidoyl)amino]hexyl]guanidine.
| Compound Name | 2-benzyl-1-[6-[(N'-benzylcarbamimidoyl)amino]hexyl]guanidine |
|---|---|
| PubChem CID | 12991061 |
| Molecular Formula | C22H32N6 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-benzyl-1-[6-[(N'-benzylcarbamimidoyl)amino]hexyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1)NCCCCCCN/C(N)=N/Cc1ccccc1 |
| InChI | InChI=1S/C22H32N6/c23-21(27-17-19-11-5-3-6-12-19)25-15-9-1-2-10-16-26-22(24)28-18-20-13-7-4-8-14-20/h3-8,11-14H,1-2,9-10,15-18H2,(H3,23,25,27)(H3,24,26,28) |
| InChIKey | NBTZKPXOUPFPBQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|