C24H36N6 — CID 155530379
2-benzyl-1-[8-[(N'-benzylcarbamimidoyl)amino]octyl]guanidine (PubChem CID 155530379) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-benzyl-1-[8-[(N'-benzylcarbamimidoyl)amino]octyl]guanidine.
| Compound Name | 2-benzyl-1-[8-[(N'-benzylcarbamimidoyl)amino]octyl]guanidine |
|---|---|
| PubChem CID | 155530379 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 2-benzyl-1-[8-[(N'-benzylcarbamimidoyl)amino]octyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1)NCCCCCCCCN/C(N)=N/Cc1ccccc1 |
| InChI | InChI=1S/C24H36N6/c25-23(29-19-21-13-7-5-8-14-21)27-17-11-3-1-2-4-12-18-28-24(26)30-20-22-15-9-6-10-16-22/h5-10,13-16H,1-4,11-12,17-20H2,(H3,25,27,29)(H3,26,28,30) |
| InChIKey | IDYJWMSACHFLHX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|