C8H12IN3O4S — CID 88653570
2-benzyl-1-iodoguanidine;sulfuric acid (PubChem CID 88653570) has the molecular formula C8H12IN3O4S and a molecular weight of 373.17 g/mol. Its IUPAC name is 2-benzyl-1-iodoguanidine;sulfuric acid.
| Compound Name | 2-benzyl-1-iodoguanidine;sulfuric acid |
|---|---|
| PubChem CID | 88653570 |
| Molecular Formula | C8H12IN3O4S |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-benzyl-1-iodoguanidine;sulfuric acid |
| SMILES | N/C(=N\Cc1ccccc1)NI.O=S(=O)(O)O |
| InChI | InChI=1S/C8H10IN3.H2O4S/c9-12-8(10)11-6-7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6H2,(H3,10,11,12);(H2,1,2,3,4) |
| InChIKey | OVSGLOISEHZNGM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|