C32H30N8 — CID 23471455
2-benzyl-1-[(E)-[10-[(E)-[(N'-benzylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine (PubChem CID 23471455) has the molecular formula C32H30N8 and a molecular weight of 526.65 g/mol. Its IUPAC name is 2-benzyl-1-[(E)-[10-[(E)-[(N'-benzylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine.
| Compound Name | 2-benzyl-1-[(E)-[10-[(E)-[(N'-benzylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 23471455 |
| Molecular Formula | C32H30N8 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 2-benzyl-1-[(E)-[10-[(E)-[(N'-benzylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine |
| SMILES | N/C(=N\Cc1ccccc1)N/N=C/c1c2ccccc2c(/C=N/N/C(N)=N/Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C32H30N8/c33-31(35-19-23-11-3-1-4-12-23)39-37-21-29-25-15-7-9-17-27(25)30(28-18-10-8-16-26(28)29)22-38-40-32(34)36-20-24-13-5-2-6-14-24/h1-18,21-22H,19-20H2,(H3,33,35,39)(H3,34,36,40)/b37-21+,38-22+ |
| InChIKey | SWKWNIYQHGYNBC-DITNJDIQSA-N |
| XLogP | 4.87 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|